C25H27ClN4O3S — CID 86273593
3-(2-chlorophenyl)-1-[1-(4-ethylphenyl)sulfonylpiperidin-4-yl]-1-pyridin-2-ylurea (PubChem CID 86273593) has the molecular formula C25H27ClN4O3S and a molecular weight of 499.04 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-1-[1-(4-ethylphenyl)sulfonylpiperidin-4-yl]-1-pyridin-2-ylurea.
| Compound Name | 3-(2-chlorophenyl)-1-[1-(4-ethylphenyl)sulfonylpiperidin-4-yl]-1-pyridin-2-ylurea |
|---|---|
| PubChem CID | 86273593 |
| Molecular Formula | C25H27ClN4O3S |
| Molecular Weight | 499.04 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 3-(2-chlorophenyl)-1-[1-(4-ethylphenyl)sulfonylpiperidin-4-yl]-1-pyridin-2-ylurea |
| SMILES | CCc1ccc(S(=O)(=O)N2CCC(N(C(=O)Nc3ccccc3Cl)c3ccccn3)CC2)cc1 |
| InChI | InChI=1S/C25H27ClN4O3S/c1-2-19-10-12-21(13-11-19)34(32,33)29-17-14-20(15-18-29)30(24-9-5-6-16-27-24)25(31)28-23-8-4-3-7-22(23)26/h3-13,16,20H,2,14-15,17-18H2,1H3,(H,28,31) |
| InChIKey | HBJLAPUIGPSUGP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.04 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |