C29H35ClN2O3S — CID 144728770
2-chloro-N-[1-(4-ethylphenyl)sulfonylpiperidin-4-yl]-N-(4-methylphenyl)benzamide;ethane (PubChem CID 144728770) has the molecular formula C29H35ClN2O3S and a molecular weight of 527.13 g/mol. Its IUPAC name is 2-chloro-N-[1-(4-ethylphenyl)sulfonylpiperidin-4-yl]-N-(4-methylphenyl)benzamide;ethane.
| Compound Name | 2-chloro-N-[1-(4-ethylphenyl)sulfonylpiperidin-4-yl]-N-(4-methylphenyl)benzamide;ethane |
|---|---|
| PubChem CID | 144728770 |
| Molecular Formula | C29H35ClN2O3S |
| Molecular Weight | 527.13 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | 2-chloro-N-[1-(4-ethylphenyl)sulfonylpiperidin-4-yl]-N-(4-methylphenyl)benzamide;ethane |
| SMILES | CC.CCc1ccc(S(=O)(=O)N2CCC(N(C(=O)c3ccccc3Cl)c3ccc(C)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H29ClN2O3S.C2H6/c1-3-21-10-14-24(15-11-21)34(32,33)29-18-16-23(17-19-29)30(22-12-8-20(2)9-13-22)27(31)25-6-4-5-7-26(25)28;1-2/h4-15,23H,3,16-19H2,1-2H3;1-2H3 |
| InChIKey | AGKNTBUXWAKWNI-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.13 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |