C26H31ClN2O2S2 — CID 144728765
N-(6-chlorocyclohexa-1,5-dien-1-yl)sulfanyl-1-(4-ethylphenyl)sulfonyl-N-(4-methylphenyl)piperidin-4-amine (PubChem CID 144728765) has the molecular formula C26H31ClN2O2S2 and a molecular weight of 503.13 g/mol. Its IUPAC name is N-(6-chlorocyclohexa-1,5-dien-1-yl)sulfanyl-1-(4-ethylphenyl)sulfonyl-N-(4-methylphenyl)piperidin-4-amine.
| Compound Name | N-(6-chlorocyclohexa-1,5-dien-1-yl)sulfanyl-1-(4-ethylphenyl)sulfonyl-N-(4-methylphenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 144728765 |
| Molecular Formula | C26H31ClN2O2S2 |
| Molecular Weight | 503.13 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | N-(6-chlorocyclohexa-1,5-dien-1-yl)sulfanyl-1-(4-ethylphenyl)sulfonyl-N-(4-methylphenyl)piperidin-4-amine |
| SMILES | CCc1ccc(S(=O)(=O)N2CCC(N(SC3=CCCC=C3Cl)c3ccc(C)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H31ClN2O2S2/c1-3-21-10-14-24(15-11-21)33(30,31)28-18-16-23(17-19-28)29(22-12-8-20(2)9-13-22)32-26-7-5-4-6-25(26)27/h6-15,23H,3-5,16-19H2,1-2H3 |
| InChIKey | FPAKQRXOVRUJCA-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.13 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|