C23H19FN6O4 — CID 86276229
N-[(E)-[2-(4-fluorophenoxy)-6-methylquinolin-3-yl]methylideneamino]-2-(2-methyl-5-nitroimidazol-1-yl)acetamide (PubChem CID 86276229) has the molecular formula C23H19FN6O4 and a molecular weight of 462.44 g/mol. Its IUPAC name is N-[(E)-[2-(4-fluorophenoxy)-6-methylquinolin-3-yl]methylideneamino]-2-(2-methyl-5-nitroimidazol-1-yl)acetamide.
| Compound Name | N-[(E)-[2-(4-fluorophenoxy)-6-methylquinolin-3-yl]methylideneamino]-2-(2-methyl-5-nitroimidazol-1-yl)acetamide |
|---|---|
| PubChem CID | 86276229 |
| Molecular Formula | C23H19FN6O4 |
| Molecular Weight | 462.44 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | N-[(E)-[2-(4-fluorophenoxy)-6-methylquinolin-3-yl]methylideneamino]-2-(2-methyl-5-nitroimidazol-1-yl)acetamide |
| SMILES | Cc1ccc2nc(Oc3ccc(F)cc3)c(/C=N/NC(=O)Cn3c([N+](=O)[O-])cnc3C)cc2c1 |
| InChI | InChI=1S/C23H19FN6O4/c1-14-3-8-20-16(9-14)10-17(23(27-20)34-19-6-4-18(24)5-7-19)11-26-28-21(31)13-29-15(2)25-12-22(29)30(32)33/h3-12H,13H2,1-2H3,(H,28,31)/b26-11+ |
| InChIKey | GDZVJYNOYOCFPD-KBKYJPHKSA-N |
| XLogP | 4.04 |
| TPSA | 124.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|