C33H37NO4S — CID 86279175
(3S)-3-[4-[2-[4-[[4-(4-methylsulfonylphenyl)piperidin-1-yl]methyl]phenyl]ethyl]phenyl]hex-4-ynoic acid (PubChem CID 86279175) has the molecular formula C33H37NO4S and a molecular weight of 543.73 g/mol. Its IUPAC name is (3S)-3-[4-[2-[4-[[4-(4-methylsulfonylphenyl)piperidin-1-yl]methyl]phenyl]ethyl]phenyl]hex-4-ynoic acid.
| Compound Name | (3S)-3-[4-[2-[4-[[4-(4-methylsulfonylphenyl)piperidin-1-yl]methyl]phenyl]ethyl]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 86279175 |
| Molecular Formula | C33H37NO4S |
| Molecular Weight | 543.73 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | (3S)-3-[4-[2-[4-[[4-(4-methylsulfonylphenyl)piperidin-1-yl]methyl]phenyl]ethyl]phenyl]hex-4-ynoic acid |
| SMILES | CC#C[C@@H](CC(=O)O)c1ccc(CCc2ccc(CN3CCC(c4ccc(S(C)(=O)=O)cc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C33H37NO4S/c1-3-4-31(23-33(35)36)29-13-11-26(12-14-29)6-5-25-7-9-27(10-8-25)24-34-21-19-30(20-22-34)28-15-17-32(18-16-28)39(2,37)38/h7-18,30-31H,5-6,19-24H2,1-2H3,(H,35,36)/t31-/m0/s1 |
| InChIKey | XBKJASHREPKGSN-HKBQPEDESA-N |
| XLogP | 5.84 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.73 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|