C13H12ClN3O2 — CID 86279587
5-[(7-chloro-1H-indol-3-yl)methyl]-1,5-dideuterio-3-(deuteriomethyl)imidazolidine-2,4-dione (PubChem CID 86279587) has the molecular formula C13H12ClN3O2 and a molecular weight of 280.73 g/mol. Its IUPAC name is 5-[(7-chloro-1H-indol-3-yl)methyl]-1,5-dideuterio-3-(deuteriomethyl)imidazolidine-2,4-dione.
| Compound Name | 5-[(7-chloro-1H-indol-3-yl)methyl]-1,5-dideuterio-3-(deuteriomethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 86279587 |
| Molecular Formula | C13H12ClN3O2 |
| Molecular Weight | 280.73 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 5-[(7-chloro-1H-indol-3-yl)methyl]-1,5-dideuterio-3-(deuteriomethyl)imidazolidine-2,4-dione |
| SMILES | [2H]CN1C(=O)N([2H])C([2H])(Cc2c[nH]c3c(Cl)cccc23)C1=O |
| InChI | InChI=1S/C13H12ClN3O2/c1-17-12(18)10(16-13(17)19)5-7-6-15-11-8(7)3-2-4-9(11)14/h2-4,6,10,15H,5H2,1H3,(H,16,19)/i1D,10D/hD |
| InChIKey | WIKGAEMMNQTUGL-ZAQCPSHVSA-N |
| XLogP | 1.91 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.73 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|