C35H51BF2N2O5 — CID 86281134
3-(difluoromethoxy)-N'-(3,5-dimethylbenzoyl)-N'-[(3R)-2,2-dimethylhexan-3-yl]-2-methyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]benzohydrazide (PubChem CID 86281134) has the molecular formula C35H51BF2N2O5 and a molecular weight of 628.61 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N'-(3,5-dimethylbenzoyl)-N'-[(3R)-2,2-dimethylhexan-3-yl]-2-methyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]benzohydrazide.
| Compound Name | 3-(difluoromethoxy)-N'-(3,5-dimethylbenzoyl)-N'-[(3R)-2,2-dimethylhexan-3-yl]-2-methyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]benzohydrazide |
|---|---|
| PubChem CID | 86281134 |
| Molecular Formula | C35H51BF2N2O5 |
| Molecular Weight | 628.61 g/mol |
| Exact Mass | 628.39 |
| IUPAC Name | 3-(difluoromethoxy)-N'-(3,5-dimethylbenzoyl)-N'-[(3R)-2,2-dimethylhexan-3-yl]-2-methyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]benzohydrazide |
| SMILES | CCC[C@@H](N(NC(=O)c1ccc(CCCB2OC(C)(C)C(C)(C)O2)c(OC(F)F)c1C)C(=O)c1cc(C)cc(C)c1)C(C)(C)C |
| InChI | InChI=1S/C35H51BF2N2O5/c1-12-14-28(33(5,6)7)40(31(42)26-20-22(2)19-23(3)21-26)39-30(41)27-17-16-25(29(24(27)4)43-32(37)38)15-13-18-36-44-34(8,9)35(10,11)45-36/h16-17,19-21,28,32H,12-15,18H2,1-11H3,(H,39,41)/t28-/m1/s1 |
| InChIKey | GCUQFTCAAIVGTC-MUUNZHRXSA-N |
| XLogP | 8.24 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.61 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|