C16H23N3O2 — CID 86285047
1-[2-[2-(dimethylamino)ethyl]piperidin-1-yl]-2-pyridin-3-ylethane-1,2-dione (PubChem CID 86285047) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 1-[2-[2-(dimethylamino)ethyl]piperidin-1-yl]-2-pyridin-3-ylethane-1,2-dione.
| Compound Name | 1-[2-[2-(dimethylamino)ethyl]piperidin-1-yl]-2-pyridin-3-ylethane-1,2-dione |
|---|---|
| PubChem CID | 86285047 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 1-[2-[2-(dimethylamino)ethyl]piperidin-1-yl]-2-pyridin-3-ylethane-1,2-dione |
| SMILES | CN(C)CCC1CCCCN1C(=O)C(=O)c1cccnc1 |
| InChI | InChI=1S/C16H23N3O2/c1-18(2)11-8-14-7-3-4-10-19(14)16(21)15(20)13-6-5-9-17-12-13/h5-6,9,12,14H,3-4,7-8,10-11H2,1-2H3 |
| InChIKey | OPEDEBFPSNBCRF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|