C20H22N2O3 — CID 95477017
1-[(2R)-2-[2-(3-hydroxyphenyl)ethyl]piperidin-1-yl]-2-pyridin-3-ylethane-1,2-dione (PubChem CID 95477017) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-[(2R)-2-[2-(3-hydroxyphenyl)ethyl]piperidin-1-yl]-2-pyridin-3-ylethane-1,2-dione.
| Compound Name | 1-[(2R)-2-[2-(3-hydroxyphenyl)ethyl]piperidin-1-yl]-2-pyridin-3-ylethane-1,2-dione |
|---|---|
| PubChem CID | 95477017 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1-[(2R)-2-[2-(3-hydroxyphenyl)ethyl]piperidin-1-yl]-2-pyridin-3-ylethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCCC[C@@H]1CCc1cccc(O)c1)c1cccnc1 |
| InChI | InChI=1S/C20H22N2O3/c23-18-8-3-5-15(13-18)9-10-17-7-1-2-12-22(17)20(25)19(24)16-6-4-11-21-14-16/h3-6,8,11,13-14,17,23H,1-2,7,9-10,12H2/t17-/m1/s1 |
| InChIKey | RWGBBDIPKTZFAC-QGZVFWFLSA-N |
| XLogP | 2.98 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|