C16H30N2O2 — CID 86285248
2-[3-[(E)-but-2-enyl]-5-(hydroxymethyl)-3,9-diazaspiro[5.5]undecan-9-yl]ethanol (PubChem CID 86285248) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 2-[3-[(E)-but-2-enyl]-5-(hydroxymethyl)-3,9-diazaspiro[5.5]undecan-9-yl]ethanol.
| Compound Name | 2-[3-[(E)-but-2-enyl]-5-(hydroxymethyl)-3,9-diazaspiro[5.5]undecan-9-yl]ethanol |
|---|---|
| PubChem CID | 86285248 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 2-[3-[(E)-but-2-enyl]-5-(hydroxymethyl)-3,9-diazaspiro[5.5]undecan-9-yl]ethanol |
| SMILES | C/C=C/CN1CCC2(CCN(CCO)CC2)C(CO)C1 |
| InChI | InChI=1S/C16H30N2O2/c1-2-3-7-18-10-6-16(15(13-18)14-20)4-8-17(9-5-16)11-12-19/h2-3,15,19-20H,4-14H2,1H3/b3-2+ |
| InChIKey | QKXMWQIJVIDGBJ-NSCUHMNNSA-N |
| XLogP | 0.95 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|