C17H20FN5O2 — CID 86286910
4-[2-(5-amino-3-methylpyrazol-1-yl)acetyl]-1-[(4-fluorophenyl)methyl]piperazin-2-one (PubChem CID 86286910) has the molecular formula C17H20FN5O2 and a molecular weight of 345.38 g/mol. Its IUPAC name is 4-[2-(5-amino-3-methylpyrazol-1-yl)acetyl]-1-[(4-fluorophenyl)methyl]piperazin-2-one.
| Compound Name | 4-[2-(5-amino-3-methylpyrazol-1-yl)acetyl]-1-[(4-fluorophenyl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 86286910 |
| Molecular Formula | C17H20FN5O2 |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 4-[2-(5-amino-3-methylpyrazol-1-yl)acetyl]-1-[(4-fluorophenyl)methyl]piperazin-2-one |
| SMILES | Cc1cc(N)n(CC(=O)N2CCN(Cc3ccc(F)cc3)C(=O)C2)n1 |
| InChI | InChI=1S/C17H20FN5O2/c1-12-8-15(19)23(20-12)11-17(25)22-7-6-21(16(24)10-22)9-13-2-4-14(18)5-3-13/h2-5,8H,6-7,9-11,19H2,1H3 |
| InChIKey | XTPVNLVOLKNPHP-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |