C28H36Br2N4 — CID 86289009
(Z)-1-(4-bromophenyl)-N-[(E)-[1-(4-bromophenyl)-3-piperidin-1-ylpropylidene]amino]-3-piperidin-1-ylpropan-1-imine (PubChem CID 86289009) has the molecular formula C28H36Br2N4 and a molecular weight of 588.43 g/mol. Its IUPAC name is (Z)-1-(4-bromophenyl)-N-[(E)-[1-(4-bromophenyl)-3-piperidin-1-ylpropylidene]amino]-3-piperidin-1-ylpropan-1-imine.
| Compound Name | (Z)-1-(4-bromophenyl)-N-[(E)-[1-(4-bromophenyl)-3-piperidin-1-ylpropylidene]amino]-3-piperidin-1-ylpropan-1-imine |
|---|---|
| PubChem CID | 86289009 |
| Molecular Formula | C28H36Br2N4 |
| Molecular Weight | 588.43 g/mol |
| Exact Mass | 586.13 |
| IUPAC Name | (Z)-1-(4-bromophenyl)-N-[(E)-[1-(4-bromophenyl)-3-piperidin-1-ylpropylidene]amino]-3-piperidin-1-ylpropan-1-imine |
| SMILES | Brc1ccc(/C(CCN2CCCCC2)=N\N=C(/CCN2CCCCC2)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C28H36Br2N4/c29-25-11-7-23(8-12-25)27(15-21-33-17-3-1-4-18-33)31-32-28(24-9-13-26(30)14-10-24)16-22-34-19-5-2-6-20-34/h7-14H,1-6,15-22H2/b31-27-,32-28+ |
| InChIKey | VWPHRHFDYARCLD-GYNJYFOTSA-N |
| XLogP | 7.16 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.43 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|