C24H31BrN2 — CID 59105340
1-[3-[2-[4-[(2-bromo-5-methylphenyl)methyl]piperidin-1-yl]ethyl]phenyl]-N-methylethanimine (PubChem CID 59105340) has the molecular formula C24H31BrN2 and a molecular weight of 427.43 g/mol. Its IUPAC name is 1-[3-[2-[4-[(2-bromo-5-methylphenyl)methyl]piperidin-1-yl]ethyl]phenyl]-N-methylethanimine.
| Compound Name | 1-[3-[2-[4-[(2-bromo-5-methylphenyl)methyl]piperidin-1-yl]ethyl]phenyl]-N-methylethanimine |
|---|---|
| PubChem CID | 59105340 |
| Molecular Formula | C24H31BrN2 |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 1-[3-[2-[4-[(2-bromo-5-methylphenyl)methyl]piperidin-1-yl]ethyl]phenyl]-N-methylethanimine |
| SMILES | C/N=C(\C)c1cccc(CCN2CCC(Cc3cc(C)ccc3Br)CC2)c1 |
| InChI | InChI=1S/C24H31BrN2/c1-18-7-8-24(25)23(15-18)17-21-10-13-27(14-11-21)12-9-20-5-4-6-22(16-20)19(2)26-3/h4-8,15-16,21H,9-14,17H2,1-3H3/b26-19+ |
| InChIKey | DIAWKIIBSQJMGC-LGUFXXKBSA-N |
| XLogP | 5.69 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|