C20H22BrFN+ — CID 146860780
1-(4-bromophenyl)-2-(2-fluoro-2-methylpropyl)-6-methyl-3,4-dihydroisoquinolin-2-ium (PubChem CID 146860780) has the molecular formula C20H22BrFN+ and a molecular weight of 375.31 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-(2-fluoro-2-methylpropyl)-6-methyl-3,4-dihydroisoquinolin-2-ium.
| Compound Name | 1-(4-bromophenyl)-2-(2-fluoro-2-methylpropyl)-6-methyl-3,4-dihydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 146860780 |
| Molecular Formula | C20H22BrFN+ |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 1-(4-bromophenyl)-2-(2-fluoro-2-methylpropyl)-6-methyl-3,4-dihydroisoquinolin-2-ium |
| SMILES | Cc1ccc2c(c1)CC[N+](CC(C)(C)F)=C2c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H22BrFN/c1-14-4-9-18-16(12-14)10-11-23(13-20(2,3)22)19(18)15-5-7-17(21)8-6-15/h4-9,12H,10-11,13H2,1-3H3/q+1 |
| InChIKey | PAXQOTZFKUVGEK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|