C15H11BrFN — CID 170646835
7-bromo-1-(2-fluorophenyl)-3,4-dihydroisoquinoline (PubChem CID 170646835) has the molecular formula C15H11BrFN and a molecular weight of 304.16 g/mol. Its IUPAC name is 7-bromo-1-(2-fluorophenyl)-3,4-dihydroisoquinoline.
| Compound Name | 7-bromo-1-(2-fluorophenyl)-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 170646835 |
| Molecular Formula | C15H11BrFN |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 7-bromo-1-(2-fluorophenyl)-3,4-dihydroisoquinoline |
| SMILES | Fc1ccccc1C1=NCCc2ccc(Br)cc21 |
| InChI | InChI=1S/C15H11BrFN/c16-11-6-5-10-7-8-18-15(13(10)9-11)12-3-1-2-4-14(12)17/h1-6,9H,7-8H2 |
| InChIKey | HLGBNJZHQNPRKD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |