C15H19BrN+ — CID 15599076
6-(2-bromophenyl)-1,2,3,4,7,8,9,9a-octahydroquinolizin-5-ium (PubChem CID 15599076) has the molecular formula C15H19BrN+ and a molecular weight of 293.23 g/mol. Its IUPAC name is 6-(2-bromophenyl)-1,2,3,4,7,8,9,9a-octahydroquinolizin-5-ium.
| Compound Name | 6-(2-bromophenyl)-1,2,3,4,7,8,9,9a-octahydroquinolizin-5-ium |
|---|---|
| PubChem CID | 15599076 |
| Molecular Formula | C15H19BrN+ |
| Molecular Weight | 293.23 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 6-(2-bromophenyl)-1,2,3,4,7,8,9,9a-octahydroquinolizin-5-ium |
| SMILES | Brc1ccccc1C1=[N+]2CCCCC2CCC1 |
| InChI | InChI=1S/C15H19BrN/c16-14-9-2-1-8-13(14)15-10-5-7-12-6-3-4-11-17(12)15/h1-2,8-9,12H,3-7,10-11H2/q+1 |
| InChIKey | CLLROMMFQRACHD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.23 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|