C22H20BrN — CID 134879977
N-[(2R)-1-(2-bromophenyl)propan-2-yl]-1,1-diphenylmethanimine (PubChem CID 134879977) has the molecular formula C22H20BrN and a molecular weight of 378.31 g/mol. Its IUPAC name is N-[(2R)-1-(2-bromophenyl)propan-2-yl]-1,1-diphenylmethanimine.
| Compound Name | N-[(2R)-1-(2-bromophenyl)propan-2-yl]-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 134879977 |
| Molecular Formula | C22H20BrN |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | N-[(2R)-1-(2-bromophenyl)propan-2-yl]-1,1-diphenylmethanimine |
| SMILES | C[C@H](Cc1ccccc1Br)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H20BrN/c1-17(16-20-14-8-9-15-21(20)23)24-22(18-10-4-2-5-11-18)19-12-6-3-7-13-19/h2-15,17H,16H2,1H3/t17-/m1/s1 |
| InChIKey | RZORJPMWPQXWAF-QGZVFWFLSA-N |
| XLogP | 5.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|