C19H15BrF5N — CID 135002725
1-(2-bromophenyl)-N-cyclohexyl-1-(2,3,4,5,6-pentafluorophenyl)methanimine (PubChem CID 135002725) has the molecular formula C19H15BrF5N and a molecular weight of 432.23 g/mol. Its IUPAC name is 1-(2-bromophenyl)-N-cyclohexyl-1-(2,3,4,5,6-pentafluorophenyl)methanimine.
| Compound Name | 1-(2-bromophenyl)-N-cyclohexyl-1-(2,3,4,5,6-pentafluorophenyl)methanimine |
|---|---|
| PubChem CID | 135002725 |
| Molecular Formula | C19H15BrF5N |
| Molecular Weight | 432.23 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | 1-(2-bromophenyl)-N-cyclohexyl-1-(2,3,4,5,6-pentafluorophenyl)methanimine |
| SMILES | Fc1c(F)c(F)c(/C(=N/C2CCCCC2)c2ccccc2Br)c(F)c1F |
| InChI | InChI=1S/C19H15BrF5N/c20-12-9-5-4-8-11(12)19(26-10-6-2-1-3-7-10)13-14(21)16(23)18(25)17(24)15(13)22/h4-5,8-10H,1-3,6-7H2/b26-19+ |
| InChIKey | JCPCBOXOTAOBMH-LGUFXXKBSA-N |
| XLogP | 6.31 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.23 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|