C21H21BrF5N — CID 56641726
1-(2-bromophenyl)-1-(2,3,4,5,6-pentafluorophenyl)-N-(2,4,4-trimethylpentan-2-yl)methanimine (PubChem CID 56641726) has the molecular formula C21H21BrF5N and a molecular weight of 462.30 g/mol. Its IUPAC name is 1-(2-bromophenyl)-1-(2,3,4,5,6-pentafluorophenyl)-N-(2,4,4-trimethylpentan-2-yl)methanimine.
| Compound Name | 1-(2-bromophenyl)-1-(2,3,4,5,6-pentafluorophenyl)-N-(2,4,4-trimethylpentan-2-yl)methanimine |
|---|---|
| PubChem CID | 56641726 |
| Molecular Formula | C21H21BrF5N |
| Molecular Weight | 462.30 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 1-(2-bromophenyl)-1-(2,3,4,5,6-pentafluorophenyl)-N-(2,4,4-trimethylpentan-2-yl)methanimine |
| SMILES | CC(C)(C)CC(C)(C)/N=C(\c1ccccc1Br)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C21H21BrF5N/c1-20(2,3)10-21(4,5)28-19(11-8-6-7-9-12(11)22)13-14(23)16(25)18(27)17(26)15(13)24/h6-9H,10H2,1-5H3/b28-19+ |
| InChIKey | DAHXPJWMSFIAMM-TURZUDJPSA-N |
| XLogP | 7.20 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.30 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|