C21H14BrF2N — CID 139186374
N-[(Z)-2-(4-bromophenyl)ethenyl]-1,1-bis(4-fluorophenyl)methanimine (PubChem CID 139186374) has the molecular formula C21H14BrF2N and a molecular weight of 398.25 g/mol. Its IUPAC name is N-[(Z)-2-(4-bromophenyl)ethenyl]-1,1-bis(4-fluorophenyl)methanimine.
| Compound Name | N-[(Z)-2-(4-bromophenyl)ethenyl]-1,1-bis(4-fluorophenyl)methanimine |
|---|---|
| PubChem CID | 139186374 |
| Molecular Formula | C21H14BrF2N |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | N-[(Z)-2-(4-bromophenyl)ethenyl]-1,1-bis(4-fluorophenyl)methanimine |
| SMILES | Fc1ccc(C(=N/C=C\c2ccc(Br)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H14BrF2N/c22-18-7-1-15(2-8-18)13-14-25-21(16-3-9-19(23)10-4-16)17-5-11-20(24)12-6-17/h1-14H/b14-13- |
| InChIKey | VZMBTZCKYFGVTH-YPKPFQOOSA-N |
| XLogP | 6.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|