C22H15BrF2N2 — CID 90430593
2-(benzhydrylideneamino)-3-(4-bromo-2,5-difluorophenyl)propanenitrile (PubChem CID 90430593) has the molecular formula C22H15BrF2N2 and a molecular weight of 425.28 g/mol. Its IUPAC name is 2-(benzhydrylideneamino)-3-(4-bromo-2,5-difluorophenyl)propanenitrile.
| Compound Name | 2-(benzhydrylideneamino)-3-(4-bromo-2,5-difluorophenyl)propanenitrile |
|---|---|
| PubChem CID | 90430593 |
| Molecular Formula | C22H15BrF2N2 |
| Molecular Weight | 425.28 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | 2-(benzhydrylideneamino)-3-(4-bromo-2,5-difluorophenyl)propanenitrile |
| SMILES | N#CC(Cc1cc(F)c(Br)cc1F)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H15BrF2N2/c23-19-13-20(24)17(12-21(19)25)11-18(14-26)27-22(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,12-13,18H,11H2 |
| InChIKey | QZQBXOGDVRSGMC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.28 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|