C22H17BrF3N — CID 166446424
N-[1-(4-bromophenyl)-3,3,3-trifluoropropyl]-1,1-diphenylmethanimine (PubChem CID 166446424) has the molecular formula C22H17BrF3N and a molecular weight of 432.28 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)-3,3,3-trifluoropropyl]-1,1-diphenylmethanimine.
| Compound Name | N-[1-(4-bromophenyl)-3,3,3-trifluoropropyl]-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 166446424 |
| Molecular Formula | C22H17BrF3N |
| Molecular Weight | 432.28 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | N-[1-(4-bromophenyl)-3,3,3-trifluoropropyl]-1,1-diphenylmethanimine |
| SMILES | FC(F)(F)CC(N=C(c1ccccc1)c1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H17BrF3N/c23-19-13-11-16(12-14-19)20(15-22(24,25)26)27-21(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-14,20H,15H2 |
| InChIKey | MYXBFTXLYPZEQO-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.28 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|