C14H16BrF3N+ — CID 135000319
1-[3-(2-bromophenyl)-1,1,1-trifluoropropan-2-ylidene]piperidin-1-ium (PubChem CID 135000319) has the molecular formula C14H16BrF3N+ and a molecular weight of 335.19 g/mol. Its IUPAC name is 1-[3-(2-bromophenyl)-1,1,1-trifluoropropan-2-ylidene]piperidin-1-ium.
| Compound Name | 1-[3-(2-bromophenyl)-1,1,1-trifluoropropan-2-ylidene]piperidin-1-ium |
|---|---|
| PubChem CID | 135000319 |
| Molecular Formula | C14H16BrF3N+ |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 1-[3-(2-bromophenyl)-1,1,1-trifluoropropan-2-ylidene]piperidin-1-ium |
| SMILES | FC(F)(F)C(Cc1ccccc1Br)=[N+]1CCCCC1 |
| InChI | InChI=1S/C14H16BrF3N/c15-12-7-3-2-6-11(12)10-13(14(16,17)18)19-8-4-1-5-9-19/h2-3,6-7H,1,4-5,8-10H2/q+1 |
| InChIKey | JDXXBRKPPIAZEP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|