C15H16BrF6NO3S — CID 135000318
1-[3-(2-bromophenyl)-1,1,1-trifluoropropan-2-ylidene]piperidin-1-ium;trifluoromethanesulfonate (PubChem CID 135000318) has the molecular formula C15H16BrF6NO3S and a molecular weight of 484.26 g/mol. Its IUPAC name is 1-[3-(2-bromophenyl)-1,1,1-trifluoropropan-2-ylidene]piperidin-1-ium;trifluoromethanesulfonate.
| Compound Name | 1-[3-(2-bromophenyl)-1,1,1-trifluoropropan-2-ylidene]piperidin-1-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 135000318 |
| Molecular Formula | C15H16BrF6NO3S |
| Molecular Weight | 484.26 g/mol |
| Exact Mass | 482.99 |
| IUPAC Name | 1-[3-(2-bromophenyl)-1,1,1-trifluoropropan-2-ylidene]piperidin-1-ium;trifluoromethanesulfonate |
| SMILES | FC(F)(F)C(Cc1ccccc1Br)=[N+]1CCCCC1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C14H16BrF3N.CHF3O3S/c15-12-7-3-2-6-11(12)10-13(14(16,17)18)19-8-4-1-5-9-19;2-1(3,4)8(5,6)7/h2-3,6-7H,1,4-5,8-10H2;(H,5,6,7)/q+1;/p-1 |
| InChIKey | UNCCSPGSLYQWLR-UHFFFAOYSA-M |
| XLogP | 4.24 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.26 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|