C16H16BrF6NO2 — CID 135000712
1-[3-(2-bromophenyl)-1,1,1-trifluoropropan-2-ylidene]piperidin-1-ium;2,2,2-trifluoroacetate (PubChem CID 135000712) has the molecular formula C16H16BrF6NO2 and a molecular weight of 448.20 g/mol. Its IUPAC name is 1-[3-(2-bromophenyl)-1,1,1-trifluoropropan-2-ylidene]piperidin-1-ium;2,2,2-trifluoroacetate.
| Compound Name | 1-[3-(2-bromophenyl)-1,1,1-trifluoropropan-2-ylidene]piperidin-1-ium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 135000712 |
| Molecular Formula | C16H16BrF6NO2 |
| Molecular Weight | 448.20 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | 1-[3-(2-bromophenyl)-1,1,1-trifluoropropan-2-ylidene]piperidin-1-ium;2,2,2-trifluoroacetate |
| SMILES | FC(F)(F)C(Cc1ccccc1Br)=[N+]1CCCCC1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C14H16BrF3N.C2HF3O2/c15-12-7-3-2-6-11(12)10-13(14(16,17)18)19-8-4-1-5-9-19;3-2(4,5)1(6)7/h2-3,6-7H,1,4-5,8-10H2;(H,6,7)/q+1;/p-1 |
| InChIKey | SKCJEJDRHKHYFH-UHFFFAOYSA-M |
| XLogP | 3.49 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.20 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|