C15H14BrF6NO2 — CID 135001097
1-[3-(2-bromophenyl)-1,1,1-trifluoropropan-2-ylidene]pyrrolidin-1-ium;2,2,2-trifluoroacetate (PubChem CID 135001097) has the molecular formula C15H14BrF6NO2 and a molecular weight of 434.17 g/mol. Its IUPAC name is 1-[3-(2-bromophenyl)-1,1,1-trifluoropropan-2-ylidene]pyrrolidin-1-ium;2,2,2-trifluoroacetate.
| Compound Name | 1-[3-(2-bromophenyl)-1,1,1-trifluoropropan-2-ylidene]pyrrolidin-1-ium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 135001097 |
| Molecular Formula | C15H14BrF6NO2 |
| Molecular Weight | 434.17 g/mol |
| Exact Mass | 433.01 |
| IUPAC Name | 1-[3-(2-bromophenyl)-1,1,1-trifluoropropan-2-ylidene]pyrrolidin-1-ium;2,2,2-trifluoroacetate |
| SMILES | FC(F)(F)C(Cc1ccccc1Br)=[N+]1CCCC1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C13H14BrF3N.C2HF3O2/c14-11-6-2-1-5-10(11)9-12(13(15,16)17)18-7-3-4-8-18;3-2(4,5)1(6)7/h1-2,5-6H,3-4,7-9H2;(H,6,7)/q+1;/p-1 |
| InChIKey | YAYVBPOPJOORJP-UHFFFAOYSA-M |
| XLogP | 3.10 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.17 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|