C13H14BrF3N+ — CID 135001098
1-[3-(2-bromophenyl)-1,1,1-trifluoropropan-2-ylidene]pyrrolidin-1-ium (PubChem CID 135001098) has the molecular formula C13H14BrF3N+ and a molecular weight of 321.16 g/mol. Its IUPAC name is 1-[3-(2-bromophenyl)-1,1,1-trifluoropropan-2-ylidene]pyrrolidin-1-ium.
| Compound Name | 1-[3-(2-bromophenyl)-1,1,1-trifluoropropan-2-ylidene]pyrrolidin-1-ium |
|---|---|
| PubChem CID | 135001098 |
| Molecular Formula | C13H14BrF3N+ |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 1-[3-(2-bromophenyl)-1,1,1-trifluoropropan-2-ylidene]pyrrolidin-1-ium |
| SMILES | FC(F)(F)C(Cc1ccccc1Br)=[N+]1CCCC1 |
| InChI | InChI=1S/C13H14BrF3N/c14-11-6-2-1-5-10(11)9-12(13(15,16)17)18-7-3-4-8-18/h1-2,5-6H,3-4,7-9H2/q+1 |
| InChIKey | BUXAHMTUKCWKRS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|