C17H13F2N3O2 — CID 86291203
2-[2-[3-fluoro-1-(3-fluoro-5-nitrophenyl)pyrrolidin-3-yl]ethynyl]pyridine (PubChem CID 86291203) has the molecular formula C17H13F2N3O2 and a molecular weight of 329.31 g/mol. Its IUPAC name is 2-[2-[3-fluoro-1-(3-fluoro-5-nitrophenyl)pyrrolidin-3-yl]ethynyl]pyridine.
| Compound Name | 2-[2-[3-fluoro-1-(3-fluoro-5-nitrophenyl)pyrrolidin-3-yl]ethynyl]pyridine |
|---|---|
| PubChem CID | 86291203 |
| Molecular Formula | C17H13F2N3O2 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 2-[2-[3-fluoro-1-(3-fluoro-5-nitrophenyl)pyrrolidin-3-yl]ethynyl]pyridine |
| SMILES | O=[N+]([O-])c1cc(F)cc(N2CCC(F)(C#Cc3ccccn3)C2)c1 |
| InChI | InChI=1S/C17H13F2N3O2/c18-13-9-15(11-16(10-13)22(23)24)21-8-6-17(19,12-21)5-4-14-3-1-2-7-20-14/h1-3,7,9-11H,6,8,12H2 |
| InChIKey | BVRMOJFUPJDQNN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|