C19H29N3OS — CID 8629370
N,N-diethyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]benzamide (PubChem CID 8629370) has the molecular formula C19H29N3OS and a molecular weight of 347.53 g/mol. Its IUPAC name is N,N-diethyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]benzamide.
| Compound Name | N,N-diethyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 8629370 |
| Molecular Formula | C19H29N3OS |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | N,N-diethyl-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]benzamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=S)N[C@@H]2CCCC[C@H]2C)c1 |
| InChI | InChI=1S/C19H29N3OS/c1-4-22(5-2)18(23)15-10-8-11-16(13-15)20-19(24)21-17-12-7-6-9-14(17)3/h8,10-11,13-14,17H,4-7,9,12H2,1-3H3,(H2,20,21,24)/t14-,17-/m1/s1 |
| InChIKey | XJYOTICDRYQPSI-RHSMWYFYSA-N |
| XLogP | 4.03 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|