C20H24F2N4O2 — CID 86297379
(2R,6R)-10-(2,4-difluorophenyl)-4-[2-(oxan-4-yl)ethyl]-7-oxa-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene (PubChem CID 86297379) has the molecular formula C20H24F2N4O2 and a molecular weight of 390.43 g/mol. Its IUPAC name is (2R,6R)-10-(2,4-difluorophenyl)-4-[2-(oxan-4-yl)ethyl]-7-oxa-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene.
| Compound Name | (2R,6R)-10-(2,4-difluorophenyl)-4-[2-(oxan-4-yl)ethyl]-7-oxa-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene |
|---|---|
| PubChem CID | 86297379 |
| Molecular Formula | C20H24F2N4O2 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | (2R,6R)-10-(2,4-difluorophenyl)-4-[2-(oxan-4-yl)ethyl]-7-oxa-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene |
| SMILES | Fc1ccc(-c2nnn3c2CO[C@@H]2CN(CCC4CCOCC4)C[C@H]23)c(F)c1 |
| InChI | InChI=1S/C20H24F2N4O2/c21-14-1-2-15(16(22)9-14)20-18-12-28-19-11-25(10-17(19)26(18)24-23-20)6-3-13-4-7-27-8-5-13/h1-2,9,13,17,19H,3-8,10-12H2/t17-,19-/m1/s1 |
| InChIKey | IXSBEWUZWQANBY-IEBWSBKVSA-N |
| XLogP | 2.80 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |