C26H30N6O6S — CID 86299096
[4-cyano-2-(2,2-dimethylpropanoylamino)phenyl]methyl (3aS,6aS)-2-(6-sulfamoylpyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 86299096) has the molecular formula C26H30N6O6S and a molecular weight of 554.63 g/mol. Its IUPAC name is [4-cyano-2-(2,2-dimethylpropanoylamino)phenyl]methyl (3aS,6aS)-2-(6-sulfamoylpyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | [4-cyano-2-(2,2-dimethylpropanoylamino)phenyl]methyl (3aS,6aS)-2-(6-sulfamoylpyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 86299096 |
| Molecular Formula | C26H30N6O6S |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | [4-cyano-2-(2,2-dimethylpropanoylamino)phenyl]methyl (3aS,6aS)-2-(6-sulfamoylpyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)C(=O)Nc1cc(C#N)ccc1COC(=O)N1C[C@@H]2CN(C(=O)c3ccc(S(N)(=O)=O)nc3)C[C@H]2C1 |
| InChI | InChI=1S/C26H30N6O6S/c1-26(2,3)24(34)30-21-8-16(9-27)4-5-18(21)15-38-25(35)32-13-19-11-31(12-20(19)14-32)23(33)17-6-7-22(29-10-17)39(28,36)37/h4-8,10,19-20H,11-15H2,1-3H3,(H,30,34)(H2,28,36,37)/t19-,20-/m0/s1 |
| InChIKey | BTYWGZMSAQDXOJ-PMACEKPBSA-N |
| XLogP | 1.93 |
| TPSA | 175.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |