C20H18N4O2 — CID 86299178
7-(3,5-dimethyl-1,2-oxazol-4-yl)-11-pyridin-2-yl-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-2-one (PubChem CID 86299178) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 7-(3,5-dimethyl-1,2-oxazol-4-yl)-11-pyridin-2-yl-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-2-one.
| Compound Name | 7-(3,5-dimethyl-1,2-oxazol-4-yl)-11-pyridin-2-yl-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-2-one |
|---|---|
| PubChem CID | 86299178 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 7-(3,5-dimethyl-1,2-oxazol-4-yl)-11-pyridin-2-yl-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-2-one |
| SMILES | Cc1noc(C)c1-c1ccc2[nH]c(=O)n3c2c1CCC3c1ccccn1 |
| InChI | InChI=1S/C20H18N4O2/c1-11-18(12(2)26-23-11)13-6-8-16-19-14(13)7-9-17(24(19)20(25)22-16)15-5-3-4-10-21-15/h3-6,8,10,17H,7,9H2,1-2H3,(H,22,25) |
| InChIKey | OQOIRRQNAUEMIT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |