C20H18ClNO3 — CID 86301017
ethyl 7-[2-(3-chlorophenyl)ethoxy]quinoline-3-carboxylate (PubChem CID 86301017) has the molecular formula C20H18ClNO3 and a molecular weight of 355.82 g/mol. Its IUPAC name is ethyl 7-[2-(3-chlorophenyl)ethoxy]quinoline-3-carboxylate.
| Compound Name | ethyl 7-[2-(3-chlorophenyl)ethoxy]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 86301017 |
| Molecular Formula | C20H18ClNO3 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | ethyl 7-[2-(3-chlorophenyl)ethoxy]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2cc(OCCc3cccc(Cl)c3)ccc2c1 |
| InChI | InChI=1S/C20H18ClNO3/c1-2-24-20(23)16-11-15-6-7-18(12-19(15)22-13-16)25-9-8-14-4-3-5-17(21)10-14/h3-7,10-13H,2,8-9H2,1H3 |
| InChIKey | QOTILERYKAXPEL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |