C27H30FNO5 — CID 86304247
3-[2-fluoro-4-[[6-[4-(3-methoxypropoxy)-2,6-dimethylphenyl]-2-pyridinyl]oxymethyl]phenyl]propanoic acid (PubChem CID 86304247) has the molecular formula C27H30FNO5 and a molecular weight of 467.54 g/mol. Its IUPAC name is 3-[2-fluoro-4-[[6-[4-(3-methoxypropoxy)-2,6-dimethylphenyl]-2-pyridinyl]oxymethyl]phenyl]propanoic acid.
| Compound Name | 3-[2-fluoro-4-[[6-[4-(3-methoxypropoxy)-2,6-dimethylphenyl]-2-pyridinyl]oxymethyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 86304247 |
| Molecular Formula | C27H30FNO5 |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 3-[2-fluoro-4-[[6-[4-(3-methoxypropoxy)-2,6-dimethylphenyl]-2-pyridinyl]oxymethyl]phenyl]propanoic acid |
| SMILES | COCCCOc1cc(C)c(-c2cccc(OCc3ccc(CCC(=O)O)c(F)c3)n2)c(C)c1 |
| InChI | InChI=1S/C27H30FNO5/c1-18-14-22(33-13-5-12-32-3)15-19(2)27(18)24-6-4-7-25(29-24)34-17-20-8-9-21(23(28)16-20)10-11-26(30)31/h4,6-9,14-16H,5,10-13,17H2,1-3H3,(H,30,31) |
| InChIKey | QYEKOCIXIOJXIZ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|