C18H12F2N2O2S — CID 86304886
5-(2,4-difluorophenyl)-2-hydroxy-N-[(E)-thiophen-2-ylmethylideneamino]benzamide (PubChem CID 86304886) has the molecular formula C18H12F2N2O2S and a molecular weight of 358.37 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)-2-hydroxy-N-[(E)-thiophen-2-ylmethylideneamino]benzamide.
| Compound Name | 5-(2,4-difluorophenyl)-2-hydroxy-N-[(E)-thiophen-2-ylmethylideneamino]benzamide |
|---|---|
| PubChem CID | 86304886 |
| Molecular Formula | C18H12F2N2O2S |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 5-(2,4-difluorophenyl)-2-hydroxy-N-[(E)-thiophen-2-ylmethylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1cccs1)c1cc(-c2ccc(F)cc2F)ccc1O |
| InChI | InChI=1S/C18H12F2N2O2S/c19-12-4-5-14(16(20)9-12)11-3-6-17(23)15(8-11)18(24)22-21-10-13-2-1-7-25-13/h1-10,23H,(H,22,24)/b21-10+ |
| InChIKey | RHGOGMSJNPIUCE-UFFVCSGVSA-N |
| XLogP | 4.16 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|