C14H21N5 — CID 86304952
N'-[[5-(3-aminophenyl)-1H-pyrazol-4-yl]methyl]-N,N'-dimethylethane-1,2-diamine (PubChem CID 86304952) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is N'-[[5-(3-aminophenyl)-1H-pyrazol-4-yl]methyl]-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-[[5-(3-aminophenyl)-1H-pyrazol-4-yl]methyl]-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 86304952 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | N'-[[5-(3-aminophenyl)-1H-pyrazol-4-yl]methyl]-N,N'-dimethylethane-1,2-diamine |
| SMILES | CNCCN(C)Cc1cn[nH]c1-c1cccc(N)c1 |
| InChI | InChI=1S/C14H21N5/c1-16-6-7-19(2)10-12-9-17-18-14(12)11-4-3-5-13(15)8-11/h3-5,8-9,16H,6-7,10,15H2,1-2H3,(H,17,18) |
| InChIKey | JFLFSGUFKAYKOZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|