C8H4F2NO4- — CID 86306842
2-(2,3-difluoro-6-nitrophenyl)acetate (PubChem CID 86306842) has the molecular formula C8H4F2NO4- and a molecular weight of 216.12 g/mol. Its IUPAC name is 2-(2,3-difluoro-6-nitrophenyl)acetate.
| Compound Name | 2-(2,3-difluoro-6-nitrophenyl)acetate |
|---|---|
| PubChem CID | 86306842 |
| Molecular Formula | C8H4F2NO4- |
| Molecular Weight | 216.12 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | 2-(2,3-difluoro-6-nitrophenyl)acetate |
| SMILES | O=C([O-])Cc1c([N+](=O)[O-])ccc(F)c1F |
| InChI | InChI=1S/C8H5F2NO4/c9-5-1-2-6(11(14)15)4(8(5)10)3-7(12)13/h1-2H,3H2,(H,12,13)/p-1 |
| InChIKey | KZNVCGPCWKYPKD-UHFFFAOYSA-M |
| XLogP | 0.17 |
| TPSA | 83.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.12 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|