C9H5F2NO5 — CID 170887010
3-(2,6-difluoro-3-nitrophenyl)-3-oxopropanoic acid (PubChem CID 170887010) has the molecular formula C9H5F2NO5 and a molecular weight of 245.14 g/mol. Its IUPAC name is 3-(2,6-difluoro-3-nitrophenyl)-3-oxopropanoic acid.
| Compound Name | 3-(2,6-difluoro-3-nitrophenyl)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 170887010 |
| Molecular Formula | C9H5F2NO5 |
| Molecular Weight | 245.14 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | 3-(2,6-difluoro-3-nitrophenyl)-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)c1c(F)ccc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C9H5F2NO5/c10-4-1-2-5(12(16)17)9(11)8(4)6(13)3-7(14)15/h1-2H,3H2,(H,14,15) |
| InChIKey | SQJCVSJUGDGTIB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.14 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|