C11H8F2N2O5 — CID 79773753
1-[(2,6-difluoro-3-nitrobenzoyl)amino]cyclopropane-1-carboxylic acid (PubChem CID 79773753) has the molecular formula C11H8F2N2O5 and a molecular weight of 286.19 g/mol. Its IUPAC name is 1-[(2,6-difluoro-3-nitrobenzoyl)amino]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[(2,6-difluoro-3-nitrobenzoyl)amino]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 79773753 |
| Molecular Formula | C11H8F2N2O5 |
| Molecular Weight | 286.19 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 1-[(2,6-difluoro-3-nitrobenzoyl)amino]cyclopropane-1-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CC1)c1c(F)ccc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C11H8F2N2O5/c12-5-1-2-6(15(19)20)8(13)7(5)9(16)14-11(3-4-11)10(17)18/h1-2H,3-4H2,(H,14,16)(H,17,18) |
| InChIKey | JCELMFOLPJLPRT-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.19 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|