C14H14F2N2O3 — CID 103839394
N-[(1-cyclopropylcyclopropyl)methyl]-2,6-difluoro-3-nitrobenzamide (PubChem CID 103839394) has the molecular formula C14H14F2N2O3 and a molecular weight of 296.27 g/mol. Its IUPAC name is N-[(1-cyclopropylcyclopropyl)methyl]-2,6-difluoro-3-nitrobenzamide.
| Compound Name | N-[(1-cyclopropylcyclopropyl)methyl]-2,6-difluoro-3-nitrobenzamide |
|---|---|
| PubChem CID | 103839394 |
| Molecular Formula | C14H14F2N2O3 |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | N-[(1-cyclopropylcyclopropyl)methyl]-2,6-difluoro-3-nitrobenzamide |
| SMILES | O=C(NCC1(C2CC2)CC1)c1c(F)ccc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C14H14F2N2O3/c15-9-3-4-10(18(20)21)12(16)11(9)13(19)17-7-14(5-6-14)8-1-2-8/h3-4,8H,1-2,5-7H2,(H,17,19) |
| InChIKey | NRLSCZZNBQQHKI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|