C13H14F2N2O3S — CID 107299298
2,6-difluoro-N-[(1-methylsulfanylcyclobutyl)methyl]-3-nitrobenzamide (PubChem CID 107299298) has the molecular formula C13H14F2N2O3S and a molecular weight of 316.33 g/mol. Its IUPAC name is 2,6-difluoro-N-[(1-methylsulfanylcyclobutyl)methyl]-3-nitrobenzamide.
| Compound Name | 2,6-difluoro-N-[(1-methylsulfanylcyclobutyl)methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 107299298 |
| Molecular Formula | C13H14F2N2O3S |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 2,6-difluoro-N-[(1-methylsulfanylcyclobutyl)methyl]-3-nitrobenzamide |
| SMILES | CSC1(CNC(=O)c2c(F)ccc([N+](=O)[O-])c2F)CCC1 |
| InChI | InChI=1S/C13H14F2N2O3S/c1-21-13(5-2-6-13)7-16-12(18)10-8(14)3-4-9(11(10)15)17(19)20/h3-4H,2,5-7H2,1H3,(H,16,18) |
| InChIKey | OVXLJGLCBHTWLO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|