C14H8BrF2NO3 — CID 79757958
2-(4-bromophenyl)-1-(2,6-difluoro-3-nitrophenyl)ethanone (PubChem CID 79757958) has the molecular formula C14H8BrF2NO3 and a molecular weight of 356.12 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-(2,6-difluoro-3-nitrophenyl)ethanone.
| Compound Name | 2-(4-bromophenyl)-1-(2,6-difluoro-3-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 79757958 |
| Molecular Formula | C14H8BrF2NO3 |
| Molecular Weight | 356.12 g/mol |
| Exact Mass | 354.97 |
| IUPAC Name | 2-(4-bromophenyl)-1-(2,6-difluoro-3-nitrophenyl)ethanone |
| SMILES | O=C(Cc1ccc(Br)cc1)c1c(F)ccc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C14H8BrF2NO3/c15-9-3-1-8(2-4-9)7-12(19)13-10(16)5-6-11(14(13)17)18(20)21/h1-6H,7H2 |
| InChIKey | OOHKNWZAKCWKKC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.12 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|