C11H5BrF2N2O3 — CID 175523250
(5-bromo-1H-pyrrol-3-yl)-(2,6-difluoro-3-nitrophenyl)methanone (PubChem CID 175523250) has the molecular formula C11H5BrF2N2O3 and a molecular weight of 331.07 g/mol. Its IUPAC name is (5-bromo-1H-pyrrol-3-yl)-(2,6-difluoro-3-nitrophenyl)methanone.
| Compound Name | (5-bromo-1H-pyrrol-3-yl)-(2,6-difluoro-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 175523250 |
| Molecular Formula | C11H5BrF2N2O3 |
| Molecular Weight | 331.07 g/mol |
| Exact Mass | 329.95 |
| IUPAC Name | (5-bromo-1H-pyrrol-3-yl)-(2,6-difluoro-3-nitrophenyl)methanone |
| SMILES | O=C(c1c[nH]c(Br)c1)c1c(F)ccc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C11H5BrF2N2O3/c12-8-3-5(4-15-8)11(17)9-6(13)1-2-7(10(9)14)16(18)19/h1-4,15H |
| InChIKey | PVLLKXGQUHIJFS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 76.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.07 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|