C15H20FNO4 — CID 86307458
(2R,3S)-3-azaniumyl-4-(3-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonyl]butanoate (PubChem CID 86307458) has the molecular formula C15H20FNO4 and a molecular weight of 297.33 g/mol. Its IUPAC name is (2R,3S)-3-azaniumyl-4-(3-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonyl]butanoate.
| Compound Name | (2R,3S)-3-azaniumyl-4-(3-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonyl]butanoate |
|---|---|
| PubChem CID | 86307458 |
| Molecular Formula | C15H20FNO4 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (2R,3S)-3-azaniumyl-4-(3-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonyl]butanoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](C(=O)[O-])[C@@H]([NH3+])Cc1cccc(F)c1 |
| InChI | InChI=1S/C15H20FNO4/c1-15(2,3)21-14(20)12(13(18)19)11(17)8-9-5-4-6-10(16)7-9/h4-7,11-12H,8,17H2,1-3H3,(H,18,19)/t11-,12+/m0/s1 |
| InChIKey | QMQPCKZZAYYOGH-NWDGAFQWSA-N |
| XLogP | -0.31 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|