(5R)-5-hydroxy-2,3,4,5-tetrahydropyridine-6-carboxylic acid

C6H9NO3 — CID 86326879

IUPAC(5R)-5-hydroxy-2,3,4,5-tetrahydropyridine-6-carboxylic acid
SMILESO=C(O)C1=NCCC[C@H]1O
InChIInChI=1S/C6H9NO3/c8-4-2-1-3-7-5(4)6(9)10/h4,8H,1-3H2,(H,9,10)/t4-/m1/s1
InChIKeyXKICOGDXIROFGF-SCSAIBSYSA-N
MW143.14 g/mol
LogP-0.33
Rot. Bonds1

About (5R)-5-hydroxy-2,3,4,5-tetrahydropyridine-6-carboxylic acid

(5R)-5-hydroxy-2,3,4,5-tetrahydropyridine-6-carboxylic acid (PubChem CID 86326879) has the molecular formula C6H9NO3 and a molecular weight of 143.14 g/mol. Its IUPAC name is (5R)-5-hydroxy-2,3,4,5-tetrahydropyridine-6-carboxylic acid.

Molecular Properties

Compound Name(5R)-5-hydroxy-2,3,4,5-tetrahydropyridine-6-carboxylic acid
PubChem CID86326879
Molecular FormulaC6H9NO3
Molecular Weight143.14 g/mol
Exact Mass143.06
IUPAC Name(5R)-5-hydroxy-2,3,4,5-tetrahydropyridine-6-carboxylic acid
SMILESO=C(O)C1=NCCC[C@H]1O
InChIInChI=1S/C6H9NO3/c8-4-2-1-3-7-5(4)6(9)10/h4,8H,1-3H2,(H,9,10)/t4-/m1/s1
InChIKeyXKICOGDXIROFGF-SCSAIBSYSA-N
XLogP-0.33
TPSA69.89 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500143.14
LogP ≤ 5-0.33
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (5R)-5-hydroxy-2,3,4,5-tetrahydropyridine-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5R)-5-hydroxy-2,3,4,5-tetrahydropyridine-6-carboxylic acid?
The IUPAC name of (5R)-5-hydroxy-2,3,4,5-tetrahydropyridine-6-carboxylic acid (CID 86326879) is (5R)-5-hydroxy-2,3,4,5-tetrahydropyridine-6-carboxylic acid.
What is the SMILES notation for (5R)-5-hydroxy-2,3,4,5-tetrahydropyridine-6-carboxylic acid?
The canonical SMILES for (5R)-5-hydroxy-2,3,4,5-tetrahydropyridine-6-carboxylic acid is O=C(O)C1=NCCC[C@H]1O.
What is the InChIKey of (5R)-5-hydroxy-2,3,4,5-tetrahydropyridine-6-carboxylic acid?
The InChIKey is XKICOGDXIROFGF-SCSAIBSYSA-N. The full InChI is InChI=1S/C6H9NO3/c8-4-2-1-3-7-5(4)6(9)10/h4,8H,1-3H2,(H,9,10)/t4-/m1/s1.
What are the key properties of (5R)-5-hydroxy-2,3,4,5-tetrahydropyridine-6-carboxylic acid?
(5R)-5-hydroxy-2,3,4,5-tetrahydropyridine-6-carboxylic acid has a molecular weight of 143.14 g/mol, XLogP of -0.33, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-hydroxy-2,3,4,5-tetrahydropyridine-6-carboxylic acid is sourced from PubChem (CID 86326879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).