About 3-hydroxy-2,3,4,5-tetrahydropyridine-2-carboxylic acid
3-hydroxy-2,3,4,5-tetrahydropyridine-2-carboxylic acid (PubChem CID 89383585) has the molecular formula C6H9NO3
and a molecular weight of 143.14 g/mol. Its IUPAC name is 3-hydroxy-2,3,4,5-tetrahydropyridine-2-carboxylic acid.
Analyze 3-hydroxy-2,3,4,5-tetrahydropyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2,3,4,5-tetrahydropyridine-2-carboxylic acid?
The IUPAC name of 3-hydroxy-2,3,4,5-tetrahydropyridine-2-carboxylic acid (CID 89383585) is 3-hydroxy-2,3,4,5-tetrahydropyridine-2-carboxylic acid.
What is the SMILES notation for 3-hydroxy-2,3,4,5-tetrahydropyridine-2-carboxylic acid?
The canonical SMILES for 3-hydroxy-2,3,4,5-tetrahydropyridine-2-carboxylic acid is O=C(O)C1N=CCCC1O.
What is the InChIKey of 3-hydroxy-2,3,4,5-tetrahydropyridine-2-carboxylic acid?
The InChIKey is JVNBICXBWYFCAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3/c8-4-2-1-3-7-5(4)6(9)10/h3-5,8H,1-2H2,(H,9,10).
What are the key properties of 3-hydroxy-2,3,4,5-tetrahydropyridine-2-carboxylic acid?
3-hydroxy-2,3,4,5-tetrahydropyridine-2-carboxylic acid has a molecular weight of 143.14 g/mol, XLogP of -0.33, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2,3,4,5-tetrahydropyridine-2-carboxylic acid is sourced from PubChem (CID 89383585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).