3-hydroxy-2,3,4,5-tetrahydropyridine-2-carboxylic acid

C6H9NO3 — CID 89383585

IUPAC3-hydroxy-2,3,4,5-tetrahydropyridine-2-carboxylic acid
SMILESO=C(O)C1N=CCCC1O
InChIInChI=1S/C6H9NO3/c8-4-2-1-3-7-5(4)6(9)10/h3-5,8H,1-2H2,(H,9,10)
InChIKeyJVNBICXBWYFCAT-UHFFFAOYSA-N
MW143.14 g/mol
LogP-0.33
Rot. Bonds1

About 3-hydroxy-2,3,4,5-tetrahydropyridine-2-carboxylic acid

3-hydroxy-2,3,4,5-tetrahydropyridine-2-carboxylic acid (PubChem CID 89383585) has the molecular formula C6H9NO3 and a molecular weight of 143.14 g/mol. Its IUPAC name is 3-hydroxy-2,3,4,5-tetrahydropyridine-2-carboxylic acid.

Molecular Properties

Compound Name3-hydroxy-2,3,4,5-tetrahydropyridine-2-carboxylic acid
PubChem CID89383585
Molecular FormulaC6H9NO3
Molecular Weight143.14 g/mol
Exact Mass143.06
IUPAC Name3-hydroxy-2,3,4,5-tetrahydropyridine-2-carboxylic acid
SMILESO=C(O)C1N=CCCC1O
InChIInChI=1S/C6H9NO3/c8-4-2-1-3-7-5(4)6(9)10/h3-5,8H,1-2H2,(H,9,10)
InChIKeyJVNBICXBWYFCAT-UHFFFAOYSA-N
XLogP-0.33
TPSA69.89 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500143.14
LogP ≤ 5-0.33
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-hydroxy-2,3,4,5-tetrahydropyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-hydroxy-2,3,4,5-tetrahydropyridine-2-carboxylic acid?
The IUPAC name of 3-hydroxy-2,3,4,5-tetrahydropyridine-2-carboxylic acid (CID 89383585) is 3-hydroxy-2,3,4,5-tetrahydropyridine-2-carboxylic acid.
What is the SMILES notation for 3-hydroxy-2,3,4,5-tetrahydropyridine-2-carboxylic acid?
The canonical SMILES for 3-hydroxy-2,3,4,5-tetrahydropyridine-2-carboxylic acid is O=C(O)C1N=CCCC1O.
What is the InChIKey of 3-hydroxy-2,3,4,5-tetrahydropyridine-2-carboxylic acid?
The InChIKey is JVNBICXBWYFCAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3/c8-4-2-1-3-7-5(4)6(9)10/h3-5,8H,1-2H2,(H,9,10).
What are the key properties of 3-hydroxy-2,3,4,5-tetrahydropyridine-2-carboxylic acid?
3-hydroxy-2,3,4,5-tetrahydropyridine-2-carboxylic acid has a molecular weight of 143.14 g/mol, XLogP of -0.33, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2,3,4,5-tetrahydropyridine-2-carboxylic acid is sourced from PubChem (CID 89383585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).