About 3-nitropyrazolo[5,4-b]pyridin-1-ide
3-nitropyrazolo[5,4-b]pyridin-1-ide (PubChem CID 86327326) has the molecular formula C6H3N4O2-
and a molecular weight of 163.12 g/mol. Its IUPAC name is 3-nitropyrazolo[5,4-b]pyridin-1-ide.
Molecular Properties
| Compound Name | 3-nitropyrazolo[5,4-b]pyridin-1-ide |
| PubChem CID | 86327326 |
| Molecular Formula | C6H3N4O2- |
| Molecular Weight | 163.12 g/mol |
| Exact Mass | 163.03 |
| IUPAC Name | 3-nitropyrazolo[5,4-b]pyridin-1-ide |
| SMILES | O=[N+]([O-])c1n[n-]c2ncccc12 |
| InChI | InChI=1S/C6H3N4O2/c11-10(12)6-4-2-1-3-7-5(4)8-9-6/h1-3H/q-1 |
| InChIKey | CHOJCSRVPSTMPL-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 83.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.12 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitropyrazolo[5,4-b]pyridin-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitropyrazolo[5,4-b]pyridin-1-ide?
The IUPAC name of 3-nitropyrazolo[5,4-b]pyridin-1-ide (CID 86327326) is 3-nitropyrazolo[5,4-b]pyridin-1-ide.
What is the SMILES notation for 3-nitropyrazolo[5,4-b]pyridin-1-ide?
The canonical SMILES for 3-nitropyrazolo[5,4-b]pyridin-1-ide is O=[N+]([O-])c1n[n-]c2ncccc12.
What is the InChIKey of 3-nitropyrazolo[5,4-b]pyridin-1-ide?
The InChIKey is CHOJCSRVPSTMPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3N4O2/c11-10(12)6-4-2-1-3-7-5(4)8-9-6/h1-3H/q-1.
What are the key properties of 3-nitropyrazolo[5,4-b]pyridin-1-ide?
3-nitropyrazolo[5,4-b]pyridin-1-ide has a molecular weight of 163.12 g/mol, XLogP of 0.50, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitropyrazolo[5,4-b]pyridin-1-ide is sourced from PubChem (CID 86327326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).