C8H14N2O — CID 86328691
(5R)-2,9-diazaspiro[4.5]decan-3-one (PubChem CID 86328691) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is (5R)-2,9-diazaspiro[4.5]decan-3-one.
| Compound Name | (5R)-2,9-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 86328691 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | (5R)-2,9-diazaspiro[4.5]decan-3-one |
| SMILES | O=C1C[C@@]2(CCCNC2)CN1 |
| InChI | InChI=1S/C8H14N2O/c11-7-4-8(6-10-7)2-1-3-9-5-8/h9H,1-6H2,(H,10,11)/t8-/m1/s1 |
| InChIKey | BBJZOKHHRARXIG-MRVPVSSYSA-N |
| XLogP | -0.12 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |