About 2,7-diazaspiro[4.5]decane-6,8-dione
2,7-diazaspiro[4.5]decane-6,8-dione (PubChem CID 146198232) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 2,7-diazaspiro[4.5]decane-6,8-dione.
Molecular Properties
| Compound Name | 2,7-diazaspiro[4.5]decane-6,8-dione |
| PubChem CID | 146198232 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 2,7-diazaspiro[4.5]decane-6,8-dione |
| SMILES | O=C1CCC2(CCNC2)C(=O)N1 |
| InChI | InChI=1S/C8H12N2O2/c11-6-1-2-8(7(12)10-6)3-4-9-5-8/h9H,1-5H2,(H,10,11,12) |
| InChIKey | UKJXZGPIUGDZMZ-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2,7-diazaspiro[4.5]decane-6,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-diazaspiro[4.5]decane-6,8-dione?
The IUPAC name of 2,7-diazaspiro[4.5]decane-6,8-dione (CID 146198232) is 2,7-diazaspiro[4.5]decane-6,8-dione.
What is the SMILES notation for 2,7-diazaspiro[4.5]decane-6,8-dione?
The canonical SMILES for 2,7-diazaspiro[4.5]decane-6,8-dione is O=C1CCC2(CCNC2)C(=O)N1.
What is the InChIKey of 2,7-diazaspiro[4.5]decane-6,8-dione?
The InChIKey is UKJXZGPIUGDZMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c11-6-1-2-8(7(12)10-6)3-4-9-5-8/h9H,1-5H2,(H,10,11,12).
What are the key properties of 2,7-diazaspiro[4.5]decane-6,8-dione?
2,7-diazaspiro[4.5]decane-6,8-dione has a molecular weight of 168.20 g/mol, XLogP of -0.60, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-diazaspiro[4.5]decane-6,8-dione is sourced from PubChem (CID 146198232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).