C8H12N2O2 — CID 146198232
2,7-diazaspiro[4.5]decane-6,8-dione (PubChem CID 146198232) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 2,7-diazaspiro[4.5]decane-6,8-dione.
| Compound Name | 2,7-diazaspiro[4.5]decane-6,8-dione |
|---|---|
| PubChem CID | 146198232 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 2,7-diazaspiro[4.5]decane-6,8-dione |
| SMILES | O=C1CCC2(CCNC2)C(=O)N1 |
| InChI | InChI=1S/C8H12N2O2/c11-6-1-2-8(7(12)10-6)3-4-9-5-8/h9H,1-5H2,(H,10,11,12) |
| InChIKey | UKJXZGPIUGDZMZ-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|