C19H23FN4OS2 — CID 8633000
1-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[[5-(3-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone (PubChem CID 8633000) has the molecular formula C19H23FN4OS2 and a molecular weight of 406.55 g/mol. Its IUPAC name is 1-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[[5-(3-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone.
| Compound Name | 1-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[[5-(3-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 8633000 |
| Molecular Formula | C19H23FN4OS2 |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 1-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[[5-(3-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone |
| SMILES | O=C(CSc1nnc(Nc2cccc(F)c2)s1)N1CCC[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C19H23FN4OS2/c20-14-7-3-8-15(11-14)21-18-22-23-19(27-18)26-12-17(25)24-10-4-6-13-5-1-2-9-16(13)24/h3,7-8,11,13,16H,1-2,4-6,9-10,12H2,(H,21,22)/t13-,16+/m1/s1 |
| InChIKey | LDQNDIFEJRMZFI-CJNGLKHVSA-N |
| XLogP | 4.69 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |